C21H17O3P — CID 14366282
(2,4-dimethylphenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanone (PubChem CID 14366282) has the molecular formula C21H17O3P and a molecular weight of 348.34 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanone.
| Compound Name | (2,4-dimethylphenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanone |
|---|---|
| PubChem CID | 14366282 |
| Molecular Formula | C21H17O3P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2,4-dimethylphenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methanone |
| SMILES | Cc1ccc(C(=O)P2(=O)Oc3ccccc3-c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H17O3P/c1-14-11-12-16(15(2)13-14)21(22)25(23)20-10-6-4-8-18(20)17-7-3-5-9-19(17)24-25/h3-13H,1-2H3 |
| InChIKey | RSZQLFWHWBIWIO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|