C13H13O2P — CID 142425353
6-methyl-1,2-dihydrobenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 142425353) has the molecular formula C13H13O2P and a molecular weight of 232.22 g/mol. Its IUPAC name is 6-methyl-1,2-dihydrobenzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-methyl-1,2-dihydrobenzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 142425353 |
| Molecular Formula | C13H13O2P |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 6-methyl-1,2-dihydrobenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CP1(=O)OC2=C(CCC=C2)c2ccccc21 |
| InChI | InChI=1S/C13H13O2P/c1-16(14)13-9-5-3-7-11(13)10-6-2-4-8-12(10)15-16/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | BETUIKKKZFRBLK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|