C38H34N4O10 — CID 118603992
6-[1,2-dihydroxy-1,2,2-tris(2-methyl-1,3-dioxo-4,5-dihydroisoindol-5-yl)ethyl]-2-methyl-4,5-dihydroisoindole-1,3-dione (PubChem CID 118603992) has the molecular formula C38H34N4O10 and a molecular weight of 706.71 g/mol. Its IUPAC name is 6-[1,2-dihydroxy-1,2,2-tris(2-methyl-1,3-dioxo-4,5-dihydroisoindol-5-yl)ethyl]-2-methyl-4,5-dihydroisoindole-1,3-dione.
| Compound Name | 6-[1,2-dihydroxy-1,2,2-tris(2-methyl-1,3-dioxo-4,5-dihydroisoindol-5-yl)ethyl]-2-methyl-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 118603992 |
| Molecular Formula | C38H34N4O10 |
| Molecular Weight | 706.71 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | 6-[1,2-dihydroxy-1,2,2-tris(2-methyl-1,3-dioxo-4,5-dihydroisoindol-5-yl)ethyl]-2-methyl-4,5-dihydroisoindole-1,3-dione |
| SMILES | CN1C(=O)C2=C(CCC(C(O)(C3C=CC4=C(C3)C(=O)N(C)C4=O)C(O)(C3C=CC4=C(C3)C(=O)N(C)C4=O)C3C=CC4=C(C3)C(=O)N(C)C4=O)=C2)C1=O |
| InChI | InChI=1S/C38H34N4O10/c1-39-29(43)21-9-5-17(13-25(21)33(39)47)37(51,18-6-10-22-26(14-18)34(48)40(2)30(22)44)38(52,19-7-11-23-27(15-19)35(49)41(3)31(23)45)20-8-12-24-28(16-20)36(50)42(4)32(24)46/h5-7,9-11,16-19,51-52H,8,12-15H2,1-4H3 |
| InChIKey | FIEOLSDCGXULIR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.71 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|