C9H10O2 — CID 141380429
5-hydroxy-2,3,4,5-tetrahydroinden-1-one (PubChem CID 141380429) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 5-hydroxy-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 5-hydroxy-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141380429 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 5-hydroxy-2,3,4,5-tetrahydroinden-1-one |
| SMILES | O=C1CCC2=C1C=CC(O)C2 |
| InChI | InChI=1S/C9H10O2/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,7,10H,1,4-5H2 |
| InChIKey | HHQMMPNASQYJSA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |