C11H12O — CID 131041323
(1S,8S)-tricyclo[6.2.1.02,6]undeca-2(6),9-dien-3-one (PubChem CID 131041323) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (1S,8S)-tricyclo[6.2.1.02,6]undeca-2(6),9-dien-3-one.
| Compound Name | (1S,8S)-tricyclo[6.2.1.02,6]undeca-2(6),9-dien-3-one |
|---|---|
| PubChem CID | 131041323 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1S,8S)-tricyclo[6.2.1.02,6]undeca-2(6),9-dien-3-one |
| SMILES | O=C1CCC2=C1[C@@H]1C=C[C@H](C2)C1 |
| InChI | InChI=1S/C11H12O/c12-10-4-3-9-6-7-1-2-8(5-7)11(9)10/h1-2,7-8H,3-6H2/t7-,8+/m0/s1 |
| InChIKey | NKFQJOSEAWLQNL-JGVFFNPUSA-N |
| XLogP | 2.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|