C11H12 — CID 14738573
tricyclo[6.2.1.02,6]undeca-2,5,9-triene (PubChem CID 14738573) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is tricyclo[6.2.1.02,6]undeca-2,5,9-triene.
| Compound Name | tricyclo[6.2.1.02,6]undeca-2,5,9-triene |
|---|---|
| PubChem CID | 14738573 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | tricyclo[6.2.1.02,6]undeca-2,5,9-triene |
| SMILES | C1=CC2CC1CC1=CCC=C12 |
| InChI | InChI=1S/C11H12/c1-2-9-6-8-4-5-10(7-8)11(9)3-1/h2-5,8,10H,1,6-7H2 |
| InChIKey | PFFMRFRCJZLYQD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|