C13H19N — CID 124659802
1-[(E)-[(1R,4S)-2-bicyclo[2.2.1]hept-5-enylidene]methyl]piperidine (PubChem CID 124659802) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-[(E)-[(1R,4S)-2-bicyclo[2.2.1]hept-5-enylidene]methyl]piperidine.
| Compound Name | 1-[(E)-[(1R,4S)-2-bicyclo[2.2.1]hept-5-enylidene]methyl]piperidine |
|---|---|
| PubChem CID | 124659802 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-[(E)-[(1R,4S)-2-bicyclo[2.2.1]hept-5-enylidene]methyl]piperidine |
| SMILES | C1=C[C@H]2C[C@H]1C/C2=C\N1CCCCC1 |
| InChI | InChI=1S/C13H19N/c1-2-6-14(7-3-1)10-13-9-11-4-5-12(13)8-11/h4-5,10-12H,1-3,6-9H2/b13-10+/t11-,12-/m0/s1 |
| InChIKey | LUUAIDJWSKPHAJ-NYKRYYGFSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|