C10H10O — CID 130027336
3,6-dihydro-2H-azulen-1-one (PubChem CID 130027336) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 3,6-dihydro-2H-azulen-1-one.
| Compound Name | 3,6-dihydro-2H-azulen-1-one |
|---|---|
| PubChem CID | 130027336 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 3,6-dihydro-2H-azulen-1-one |
| SMILES | O=C1CCC2=C1C=CCC=C2 |
| InChI | InChI=1S/C10H10O/c11-10-7-6-8-4-2-1-3-5-9(8)10/h2-5H,1,6-7H2 |
| InChIKey | RGIWIRBRKUTBDV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |