About 7H-benzo[7]annulene-1,4-dione;ethane
7H-benzo[7]annulene-1,4-dione;ethane (PubChem CID 144756448) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 7H-benzo[7]annulene-1,4-dione;ethane.
Molecular Properties
| Compound Name | 7H-benzo[7]annulene-1,4-dione;ethane |
| PubChem CID | 144756448 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 7H-benzo[7]annulene-1,4-dione;ethane |
| SMILES | CC.O=C1C=CC(=O)C2=C1C=CCC=C2 |
| InChI | InChI=1S/C11H8O2.C2H6/c12-10-6-7-11(13)9-5-3-1-2-4-8(9)10;1-2/h2-7H,1H2;1-2H3 |
| InChIKey | VWAAAPQLSOWGDO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 7H-benzo[7]annulene-1,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-benzo[7]annulene-1,4-dione;ethane?
The IUPAC name of 7H-benzo[7]annulene-1,4-dione;ethane (CID 144756448) is 7H-benzo[7]annulene-1,4-dione;ethane.
What is the SMILES notation for 7H-benzo[7]annulene-1,4-dione;ethane?
The canonical SMILES for 7H-benzo[7]annulene-1,4-dione;ethane is CC.O=C1C=CC(=O)C2=C1C=CCC=C2.
What is the InChIKey of 7H-benzo[7]annulene-1,4-dione;ethane?
The InChIKey is VWAAAPQLSOWGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.C2H6/c12-10-6-7-11(13)9-5-3-1-2-4-8(9)10;1-2/h2-7H,1H2;1-2H3.
What are the key properties of 7H-benzo[7]annulene-1,4-dione;ethane?
7H-benzo[7]annulene-1,4-dione;ethane has a molecular weight of 202.25 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-benzo[7]annulene-1,4-dione;ethane is sourced from PubChem (CID 144756448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).