C21H31N3O4 — CID 145346255
tert-butyl N-[1-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethyl]piperidin-4-yl]-N-methylcarbamate (PubChem CID 145346255) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethyl]piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethyl]piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 145346255 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[1-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethyl]piperidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(CCN2C(=O)C3=C(CCC=C3)C2=O)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-21(2,3)28-20(27)22(4)15-9-11-23(12-10-15)13-14-24-18(25)16-7-5-6-8-17(16)19(24)26/h5,7,15H,6,8-14H2,1-4H3 |
| InChIKey | OZGJVJSNTJRWRY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|