C5H5I2NO2V — CID 162217566
diiodovanadium;1-methylpyrrole-2,5-dione (PubChem CID 162217566) has the molecular formula C5H5I2NO2V and a molecular weight of 415.85 g/mol. Its IUPAC name is diiodovanadium;1-methylpyrrole-2,5-dione.
| Compound Name | diiodovanadium;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 162217566 |
| Molecular Formula | C5H5I2NO2V |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.78 |
| IUPAC Name | diiodovanadium;1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C=CC1=O.I[V]I |
| InChI | InChI=1S/C5H5NO2.2HI.V/c1-6-4(7)2-3-5(6)8;;;/h2-3H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZTRFSRDBFSAZIE-UHFFFAOYSA-L |
| XLogP | 1.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|