C12H16N2O4 — CID 162091684
methane;1-methyl-3-methylidenepyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione (PubChem CID 162091684) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is methane;1-methyl-3-methylidenepyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione.
| Compound Name | methane;1-methyl-3-methylidenepyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 162091684 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methane;1-methyl-3-methylidenepyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
| SMILES | C.C=C1CC(=O)N(C)C1=O.CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H7NO2.C5H5NO2.CH4/c1-4-3-5(8)7(2)6(4)9;1-6-4(7)2-3-5(6)8;/h1,3H2,2H3;2-3H,1H3;1H4 |
| InChIKey | ZDRVJZHOHOPVPL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|