C11H10N2O4 — CID 165109067
3-methylidene-1-[(3-methylidene-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 165109067) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-methylidene-1-[(3-methylidene-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methylidene-1-[(3-methylidene-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 165109067 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-methylidene-1-[(3-methylidene-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | C=C1CC(=O)N(CN2C(=O)CC(=C)C2=O)C1=O |
| InChI | InChI=1S/C11H10N2O4/c1-6-3-8(14)12(10(6)16)5-13-9(15)4-7(2)11(13)17/h1-5H2 |
| InChIKey | JTIMVMPDSLZMFK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|