C7H5NO2 — CID 164846198
1-ethynyl-3-methylidenepyrrolidine-2,5-dione (PubChem CID 164846198) has the molecular formula C7H5NO2 and a molecular weight of 135.12 g/mol. Its IUPAC name is 1-ethynyl-3-methylidenepyrrolidine-2,5-dione.
| Compound Name | 1-ethynyl-3-methylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 164846198 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 1-ethynyl-3-methylidenepyrrolidine-2,5-dione |
| SMILES | C#CN1C(=O)CC(=C)C1=O |
| InChI | InChI=1S/C7H5NO2/c1-3-8-6(9)4-5(2)7(8)10/h1H,2,4H2 |
| InChIKey | GTHHNLQBYDXFET-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|