C9H16N2O2 — CID 142439649
1-(2-aminoethyl)-3-methylidenepyrrolidine-2,5-dione;ethane (PubChem CID 142439649) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-methylidenepyrrolidine-2,5-dione;ethane.
| Compound Name | 1-(2-aminoethyl)-3-methylidenepyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 142439649 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-(2-aminoethyl)-3-methylidenepyrrolidine-2,5-dione;ethane |
| SMILES | C=C1CC(=O)N(CCN)C1=O.CC |
| InChI | InChI=1S/C7H10N2O2.C2H6/c1-5-4-6(10)9(3-2-8)7(5)11;1-2/h1-4,8H2;1-2H3 |
| InChIKey | STLUFMUPHOWLOL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|