C12H14N2O2 — CID 103429602
2-(2-aminoethyl)-4,7-dimethylisoindole-1,3-dione (PubChem CID 103429602) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4,7-dimethylisoindole-1,3-dione.
| Compound Name | 2-(2-aminoethyl)-4,7-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 103429602 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-(2-aminoethyl)-4,7-dimethylisoindole-1,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)N(CCN)C2=O |
| InChI | InChI=1S/C12H14N2O2/c1-7-3-4-8(2)10-9(7)11(15)14(6-5-13)12(10)16/h3-4H,5-6,13H2,1-2H3 |
| InChIKey | PPKSGOXDIWBVCB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|