C13H15NO3 — CID 103430866
2-(3-hydroxypropyl)-4,7-dimethylisoindole-1,3-dione (PubChem CID 103430866) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-4,7-dimethylisoindole-1,3-dione.
| Compound Name | 2-(3-hydroxypropyl)-4,7-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 103430866 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(3-hydroxypropyl)-4,7-dimethylisoindole-1,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)N(CCCO)C2=O |
| InChI | InChI=1S/C13H15NO3/c1-8-4-5-9(2)11-10(8)12(16)14(13(11)17)6-3-7-15/h4-5,15H,3,6-7H2,1-2H3 |
| InChIKey | AJFUDWFVLKIWCL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|