C9H18N2O2S — CID 142329747
1-(2-aminoethyl)-3-sulfanylpyrrolidine-2,5-dione;propane (PubChem CID 142329747) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-sulfanylpyrrolidine-2,5-dione;propane.
| Compound Name | 1-(2-aminoethyl)-3-sulfanylpyrrolidine-2,5-dione;propane |
|---|---|
| PubChem CID | 142329747 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-(2-aminoethyl)-3-sulfanylpyrrolidine-2,5-dione;propane |
| SMILES | CCC.NCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C6H10N2O2S.C3H8/c7-1-2-8-5(9)3-4(11)6(8)10;1-3-2/h4,11H,1-3,7H2;3H2,1-2H3 |
| InChIKey | LBFASLVJWYNYHJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|