C14H24N2O7S — CID 71581754
2-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]acetamide (PubChem CID 71581754) has the molecular formula C14H24N2O7S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]acetamide.
| Compound Name | 2-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 71581754 |
| Molecular Formula | C14H24N2O7S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]acetamide |
| SMILES | NC(=O)COCCOCCOCCOCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C14H24N2O7S/c15-12(17)10-23-8-7-22-6-5-21-4-3-20-2-1-16-13(18)9-11(24)14(16)19/h11,24H,1-10H2,(H2,15,17) |
| InChIKey | UXZOTCAZMUICBR-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|