C16H29NO5 — CID 176682927
ethane;1-[2-[2-(2-oxopropoxy)ethoxy]ethyl]-3-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 176682927) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is ethane;1-[2-[2-(2-oxopropoxy)ethoxy]ethyl]-3-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | ethane;1-[2-[2-(2-oxopropoxy)ethoxy]ethyl]-3-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176682927 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | ethane;1-[2-[2-(2-oxopropoxy)ethoxy]ethyl]-3-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC.CC(=O)COCCOCCN1C(=O)CC(C(C)C)C1=O |
| InChI | InChI=1S/C14H23NO5.C2H6/c1-10(2)12-8-13(17)15(14(12)18)4-5-19-6-7-20-9-11(3)16;1-2/h10,12H,4-9H2,1-3H3;1-2H3 |
| InChIKey | XAHHQGHJDRTYFR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|