C18H31NO4 — CID 157219213
1-[6-(3-methylbutoxy)-4-oxohexyl]-3-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 157219213) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-[6-(3-methylbutoxy)-4-oxohexyl]-3-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[6-(3-methylbutoxy)-4-oxohexyl]-3-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157219213 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 1-[6-(3-methylbutoxy)-4-oxohexyl]-3-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)CCOCCC(=O)CCCN1C(=O)CC(C(C)C)C1=O |
| InChI | InChI=1S/C18H31NO4/c1-13(2)7-10-23-11-8-15(20)6-5-9-19-17(21)12-16(14(3)4)18(19)22/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | IDDZDXYZPXSVBL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|