C21H30N2O7 — CID 159184415
1-[4-[5-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-4-oxopentoxy]-2-oxobutyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 159184415) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-[4-[5-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-4-oxopentoxy]-2-oxobutyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-[5-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-4-oxopentoxy]-2-oxobutyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159184415 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[4-[5-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-4-oxopentoxy]-2-oxobutyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CC(=O)CCOCCCC(=O)CN2C(=O)CC(C(C)C)C2=O)C1=O |
| InChI | InChI=1S/C21H30N2O7/c1-13(2)17-10-19(27)23(21(17)29)11-15(24)5-4-7-30-8-6-16(25)12-22-18(26)9-14(3)20(22)28/h13-14,17H,4-12H2,1-3H3 |
| InChIKey | DSHFLRRSTUTHSM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|