C19H34N2O5 — CID 153317713
N-[2-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)ethyl]-3-[2-(3-methylbutoxy)ethoxy]propanamide (PubChem CID 153317713) has the molecular formula C19H34N2O5 and a molecular weight of 370.49 g/mol. Its IUPAC name is N-[2-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)ethyl]-3-[2-(3-methylbutoxy)ethoxy]propanamide.
| Compound Name | N-[2-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)ethyl]-3-[2-(3-methylbutoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 153317713 |
| Molecular Formula | C19H34N2O5 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | N-[2-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)ethyl]-3-[2-(3-methylbutoxy)ethoxy]propanamide |
| SMILES | CC(C)CCOCCOCCC(=O)NCCN1C(=O)CC(C(C)C)C1=O |
| InChI | InChI=1S/C19H34N2O5/c1-14(2)5-9-25-11-12-26-10-6-17(22)20-7-8-21-18(23)13-16(15(3)4)19(21)24/h14-16H,5-13H2,1-4H3,(H,20,22) |
| InChIKey | IOLFXZPMZVLTOG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|