C16H29N3O5S — CID 90126300
3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)ethyl]propanamide (PubChem CID 90126300) has the molecular formula C16H29N3O5S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)ethyl]propanamide.
| Compound Name | 3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 90126300 |
| Molecular Formula | C16H29N3O5S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)ethyl]propanamide |
| SMILES | CCNCCOCCOCCC(=O)NCCN1C(=O)CC(SC)C1=O |
| InChI | InChI=1S/C16H29N3O5S/c1-3-17-6-9-24-11-10-23-8-4-14(20)18-5-7-19-15(21)12-13(25-2)16(19)22/h13,17H,3-12H2,1-2H3,(H,18,20) |
| InChIKey | FGSLRPRZAQELTO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|