C17H29NO7S — CID 159429749
3-methylsulfanyl-1-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrolidine-2,5-dione (PubChem CID 159429749) has the molecular formula C17H29NO7S and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-methylsulfanyl-1-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methylsulfanyl-1-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159429749 |
| Molecular Formula | C17H29NO7S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 3-methylsulfanyl-1-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrolidine-2,5-dione |
| SMILES | CSC1CC(=O)N(CCOCCOCCOCCOCCC(C)=O)C1=O |
| InChI | InChI=1S/C17H29NO7S/c1-14(19)3-5-22-7-9-24-11-12-25-10-8-23-6-4-18-16(20)13-15(26-2)17(18)21/h15H,3-13H2,1-2H3 |
| InChIKey | WYVWEASZURYHKX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|