C15H25N3O4S — CID 89353330
4-amino-N-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethyl]-6-methyl-5-oxooctanamide (PubChem CID 89353330) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-amino-N-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethyl]-6-methyl-5-oxooctanamide.
| Compound Name | 4-amino-N-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethyl]-6-methyl-5-oxooctanamide |
|---|---|
| PubChem CID | 89353330 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-amino-N-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethyl]-6-methyl-5-oxooctanamide |
| SMILES | CCC(C)C(=O)C(N)CCC(=O)NCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C15H25N3O4S/c1-3-9(2)14(21)10(16)4-5-12(19)17-6-7-18-13(20)8-11(23)15(18)22/h9-11,23H,3-8,16H2,1-2H3,(H,17,19) |
| InChIKey | ZFVWPDUNGHYWDB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|