C13H23N2O6PS2 — CID 166462592
6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanoylamino]hexyl sulfanyl hydrogen phosphite (PubChem CID 166462592) has the molecular formula C13H23N2O6PS2 and a molecular weight of 398.44 g/mol. Its IUPAC name is 6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanoylamino]hexyl sulfanyl hydrogen phosphite.
| Compound Name | 6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanoylamino]hexyl sulfanyl hydrogen phosphite |
|---|---|
| PubChem CID | 166462592 |
| Molecular Formula | C13H23N2O6PS2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanoylamino]hexyl sulfanyl hydrogen phosphite |
| SMILES | O=C(CCN1C(=O)CC(S)C1=O)NCCCCCCOP(O)OS |
| InChI | InChI=1S/C13H23N2O6PS2/c16-11(5-7-15-12(17)9-10(23)13(15)18)14-6-3-1-2-4-8-20-22(19)21-24/h10,19,23-24H,1-9H2,(H,14,16) |
| InChIKey | HCBHRVGNFIAFNE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|