C20H35N2O6P — CID 164986885
3-(2,5-dioxo-3-phosphanylpyrrolidin-1-yl)-N-[9-(1-ethoxyethoxy)-6-oxononyl]propanamide (PubChem CID 164986885) has the molecular formula C20H35N2O6P and a molecular weight of 430.48 g/mol. Its IUPAC name is 3-(2,5-dioxo-3-phosphanylpyrrolidin-1-yl)-N-[9-(1-ethoxyethoxy)-6-oxononyl]propanamide.
| Compound Name | 3-(2,5-dioxo-3-phosphanylpyrrolidin-1-yl)-N-[9-(1-ethoxyethoxy)-6-oxononyl]propanamide |
|---|---|
| PubChem CID | 164986885 |
| Molecular Formula | C20H35N2O6P |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-(2,5-dioxo-3-phosphanylpyrrolidin-1-yl)-N-[9-(1-ethoxyethoxy)-6-oxononyl]propanamide |
| SMILES | CCOC(C)OCCCC(=O)CCCCCNC(=O)CCN1C(=O)CC(P)C1=O |
| InChI | InChI=1S/C20H35N2O6P/c1-3-27-15(2)28-13-7-9-16(23)8-5-4-6-11-21-18(24)10-12-22-19(25)14-17(29)20(22)26/h15,17H,3-14,29H2,1-2H3,(H,21,24) |
| InChIKey | NEBLYNXFWLOJSB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|