C11H16BN3O3S — CID 145098105
CID 145098105 (PubChem CID 145098105) has the molecular formula C11H16BN3O3S and a molecular weight of 281.15 g/mol.
| Compound Name | CID 145098105 |
|---|---|
| PubChem CID | 145098105 |
| Molecular Formula | C11H16BN3O3S |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | — |
| SMILES | [B]/C=N/NC(=O)CCCCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C11H16BN3O3S/c12-7-13-14-9(16)4-2-1-3-5-15-10(17)6-8(19)11(15)18/h7-8,19H,1-6H2,(H,14,16)/b13-7+ |
| InChIKey | HKSDUSAULYHIRC-NTUHNPAUSA-N |
| XLogP | -0.17 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|