C20H19N3O5 — CID 143553411
2-methylisoindole-1,3-dione;1-methylpyridin-2-one;1-methylpyrrole-2,5-dione (PubChem CID 143553411) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-methylisoindole-1,3-dione;1-methylpyridin-2-one;1-methylpyrrole-2,5-dione.
| Compound Name | 2-methylisoindole-1,3-dione;1-methylpyridin-2-one;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 143553411 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-methylisoindole-1,3-dione;1-methylpyridin-2-one;1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C=CC1=O.CN1C(=O)c2ccccc2C1=O.Cn1ccccc1=O |
| InChI | InChI=1S/C9H7NO2.C6H7NO.C5H5NO2/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;1-7-5-3-2-4-6(7)8;1-6-4(7)2-3-5(6)8/h2-5H,1H3;2-5H,1H3;2-3H,1H3 |
| InChIKey | AKPLKJHOPGVEPN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|