C19H14N2O4 — CID 159383507
2-aminoanthracene-9,10-dione;1-methylpyrrole-2,5-dione (PubChem CID 159383507) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-aminoanthracene-9,10-dione;1-methylpyrrole-2,5-dione.
| Compound Name | 2-aminoanthracene-9,10-dione;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 159383507 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-aminoanthracene-9,10-dione;1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C=CC1=O.Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO2.C5H5NO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16;1-6-4(7)2-3-5(6)8/h1-7H,15H2;2-3H,1H3 |
| InChIKey | LLEYFOLTCKCGPD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|