About 2-methylisoindole-1,3-dione;pyridine
2-methylisoindole-1,3-dione;pyridine (PubChem CID 174877202) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-methylisoindole-1,3-dione;pyridine.
Molecular Properties
| Compound Name | 2-methylisoindole-1,3-dione;pyridine |
| PubChem CID | 174877202 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-methylisoindole-1,3-dione;pyridine |
| SMILES | CN1C(=O)c2ccccc2C1=O.c1ccncc1 |
| InChI | InChI=1S/C9H7NO2.C5H5N/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;1-2-4-6-5-3-1/h2-5H,1H3;1-5H |
| InChIKey | MFNZNCRRPMGGTK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylisoindole-1,3-dione;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylisoindole-1,3-dione;pyridine?
The IUPAC name of 2-methylisoindole-1,3-dione;pyridine (CID 174877202) is 2-methylisoindole-1,3-dione;pyridine.
What is the SMILES notation for 2-methylisoindole-1,3-dione;pyridine?
The canonical SMILES for 2-methylisoindole-1,3-dione;pyridine is CN1C(=O)c2ccccc2C1=O.c1ccncc1.
What is the InChIKey of 2-methylisoindole-1,3-dione;pyridine?
The InChIKey is MFNZNCRRPMGGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C5H5N/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;1-2-4-6-5-3-1/h2-5H,1H3;1-5H.
What are the key properties of 2-methylisoindole-1,3-dione;pyridine?
2-methylisoindole-1,3-dione;pyridine has a molecular weight of 240.26 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylisoindole-1,3-dione;pyridine is sourced from PubChem (CID 174877202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).