C31H20N2O2 — CID 155773610
6-(4-carbazol-9-ylphenyl)-2-methylbenzo[de]isoquinoline-1,3-dione (PubChem CID 155773610) has the molecular formula C31H20N2O2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 6-(4-carbazol-9-ylphenyl)-2-methylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(4-carbazol-9-ylphenyl)-2-methylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 155773610 |
| Molecular Formula | C31H20N2O2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 6-(4-carbazol-9-ylphenyl)-2-methylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CN1C(=O)c2cccc3c(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C31H20N2O2/c1-32-30(34)25-10-6-9-24-21(17-18-26(29(24)25)31(32)35)19-13-15-20(16-14-19)33-27-11-4-2-7-22(27)23-8-3-5-12-28(23)33/h2-18H,1H3 |
| InChIKey | LKDDUXZJQYLEBV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|