C14H18N2O2 — CID 153376535
2-methylisoindole-1,3-dione;piperidine (PubChem CID 153376535) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-methylisoindole-1,3-dione;piperidine.
| Compound Name | 2-methylisoindole-1,3-dione;piperidine |
|---|---|
| PubChem CID | 153376535 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-methylisoindole-1,3-dione;piperidine |
| SMILES | C1CCNCC1.CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C9H7NO2.C5H11N/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;1-2-4-6-5-3-1/h2-5H,1H3;6H,1-5H2 |
| InChIKey | RRJAZYNPWMQICR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|