C29H29N3O4 — CID 159617958
2-methylbenzo[de]isoquinoline-1,3-dione;N-methylcyclohexanimine;2-methylisoindole-1,3-dione (PubChem CID 159617958) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-methylbenzo[de]isoquinoline-1,3-dione;N-methylcyclohexanimine;2-methylisoindole-1,3-dione.
| Compound Name | 2-methylbenzo[de]isoquinoline-1,3-dione;N-methylcyclohexanimine;2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 159617958 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-methylbenzo[de]isoquinoline-1,3-dione;N-methylcyclohexanimine;2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2cccc3cccc(c23)C1=O.CN1C(=O)c2ccccc2C1=O.CN=C1CCCCC1 |
| InChI | InChI=1S/C13H9NO2.C9H7NO2.C7H13N/c1-14-12(15)9-6-2-4-8-5-3-7-10(11(8)9)13(14)16;1-10-8(11)6-4-2-3-5-7(6)9(10)12;1-8-7-5-3-2-4-6-7/h2-7H,1H3;2-5H,1H3;2-6H2,1H3 |
| InChIKey | MNNGEPXDCYJXFT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|