C14H18NP — CID 143491796
[(2Z,4E,7Z)-1,6-dimethyl-4-pyrrol-1-ylcycloocta-2,4,7-trien-1-yl]phosphane (PubChem CID 143491796) has the molecular formula C14H18NP and a molecular weight of 231.28 g/mol. Its IUPAC name is [(2Z,4E,7Z)-1,6-dimethyl-4-pyrrol-1-ylcycloocta-2,4,7-trien-1-yl]phosphane.
| Compound Name | [(2Z,4E,7Z)-1,6-dimethyl-4-pyrrol-1-ylcycloocta-2,4,7-trien-1-yl]phosphane |
|---|---|
| PubChem CID | 143491796 |
| Molecular Formula | C14H18NP |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | [(2Z,4E,7Z)-1,6-dimethyl-4-pyrrol-1-ylcycloocta-2,4,7-trien-1-yl]phosphane |
| SMILES | CC1/C=C\C(C)(P)/C=C\C(n2cccc2)=C/1 |
| InChI | InChI=1S/C14H18NP/c1-12-5-7-14(2,16)8-6-13(11-12)15-9-3-4-10-15/h3-12H,16H2,1-2H3/b7-5-,8-6-,13-11+ |
| InChIKey | AZPBTJMMWIMMBC-ILHRLNBPSA-N |
| XLogP | 3.72 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|