C16H16 — CID 58792602
2,6-dimethyl-2,6-dihydroanthracene (PubChem CID 58792602) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,6-dimethyl-2,6-dihydroanthracene.
| Compound Name | 2,6-dimethyl-2,6-dihydroanthracene |
|---|---|
| PubChem CID | 58792602 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,6-dimethyl-2,6-dihydroanthracene |
| SMILES | CC1C=Cc2cc3c(cc2=C1)C=CC(C)C=3 |
| InChI | InChI=1S/C16H16/c1-11-3-5-13-10-16-8-12(2)4-6-14(16)9-15(13)7-11/h3-12H,1-2H3 |
| InChIKey | HWWBVYXPRSKSSC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |