C18H18 — CID 144902397
(1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene (PubChem CID 144902397) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene.
| Compound Name | (1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene |
|---|---|
| PubChem CID | 144902397 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene |
| SMILES | CC1=C/C(C)/C=C\c2cccc3c2C\C(=C/1)C=C3 |
| InChI | InChI=1S/C18H18/c1-13-6-8-16-4-3-5-17-9-7-15(12-18(16)17)11-14(2)10-13/h3-11,13H,12H2,1-2H3/b8-6-,14-10-,15-11- |
| InChIKey | HTGSNTJRPNIMFQ-OUQXRYENSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |