C12H13Br — CID 143486555
8-bromo-2,3-dimethyl-1,2-dihydronaphthalene (PubChem CID 143486555) has the molecular formula C12H13Br and a molecular weight of 237.14 g/mol. Its IUPAC name is 8-bromo-2,3-dimethyl-1,2-dihydronaphthalene.
| Compound Name | 8-bromo-2,3-dimethyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 143486555 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 8-bromo-2,3-dimethyl-1,2-dihydronaphthalene |
| SMILES | CC1=Cc2cccc(Br)c2CC1C |
| InChI | InChI=1S/C12H13Br/c1-8-6-10-4-3-5-12(13)11(10)7-9(8)2/h3-6,9H,7H2,1-2H3 |
| InChIKey | ZGLDKGHFZMJEDA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |