C14H18 — CID 142934996
2-methyl-8-propyl-1,2-dihydronaphthalene (PubChem CID 142934996) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-methyl-8-propyl-1,2-dihydronaphthalene.
| Compound Name | 2-methyl-8-propyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 142934996 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-methyl-8-propyl-1,2-dihydronaphthalene |
| SMILES | CCCc1cccc2c1CC(C)C=C2 |
| InChI | InChI=1S/C14H18/c1-3-5-12-6-4-7-13-9-8-11(2)10-14(12)13/h4,6-9,11H,3,5,10H2,1-2H3 |
| InChIKey | HGUZQEDTJSPOSL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |