C13H16O2 — CID 56613123
2-methyl-8-propyl-2,3-dihydrochromen-4-one (PubChem CID 56613123) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methyl-8-propyl-2,3-dihydrochromen-4-one.
| Compound Name | 2-methyl-8-propyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 56613123 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-methyl-8-propyl-2,3-dihydrochromen-4-one |
| SMILES | CCCc1cccc2c1OC(C)CC2=O |
| InChI | InChI=1S/C13H16O2/c1-3-5-10-6-4-7-11-12(14)8-9(2)15-13(10)11/h4,6-7,9H,3,5,8H2,1-2H3 |
| InChIKey | VURUBYUDHIVUNY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |