C13H12 — CID 144601086
5-methyl-4,5-dihydroacenaphthylene (PubChem CID 144601086) has the molecular formula C13H12 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-methyl-4,5-dihydroacenaphthylene.
| Compound Name | 5-methyl-4,5-dihydroacenaphthylene |
|---|---|
| PubChem CID | 144601086 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-methyl-4,5-dihydroacenaphthylene |
| SMILES | CC1CC=C2C=Cc3cccc1c32 |
| InChI | InChI=1S/C13H12/c1-9-5-6-11-8-7-10-3-2-4-12(9)13(10)11/h2-4,6-9H,5H2,1H3 |
| InChIKey | CEPALXAQQITKAA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |