C20H20 — CID 144902396
acetylene;(1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene (PubChem CID 144902396) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is acetylene;(1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene.
| Compound Name | acetylene;(1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene |
|---|---|
| PubChem CID | 144902396 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | acetylene;(1E,9Z,12Z)-11,13-dimethyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene |
| SMILES | C#C.CC1=C/C(C)/C=C\c2cccc3c2C\C(=C/1)C=C3 |
| InChI | InChI=1S/C18H18.C2H2/c1-13-6-8-16-4-3-5-17-9-7-15(12-18(16)17)11-14(2)10-13;1-2/h3-11,13H,12H2,1-2H3;1-2H/b8-6-,14-10-,15-11-; |
| InChIKey | FFYJZXJIJRMHHD-IJNROQDGSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|