C10H16Zr — CID 174290613
2-butyl-5-methylcyclopenta-1,3-diene;zirconium (PubChem CID 174290613) has the molecular formula C10H16Zr and a molecular weight of 227.46 g/mol. Its IUPAC name is 2-butyl-5-methylcyclopenta-1,3-diene;zirconium.
| Compound Name | 2-butyl-5-methylcyclopenta-1,3-diene;zirconium |
|---|---|
| PubChem CID | 174290613 |
| Molecular Formula | C10H16Zr |
| Molecular Weight | 227.46 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-butyl-5-methylcyclopenta-1,3-diene;zirconium |
| SMILES | CCCCC1=CC(C)C=C1.[Zr] |
| InChI | InChI=1S/C10H16.Zr/c1-3-4-5-10-7-6-9(2)8-10;/h6-9H,3-5H2,1-2H3; |
| InChIKey | OPJNLTVJKCYTFZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |