C10H16F2Zr — CID 174700660
2-butyl-5-methylcyclopenta-1,3-diene;difluorozirconium (PubChem CID 174700660) has the molecular formula C10H16F2Zr and a molecular weight of 265.46 g/mol. Its IUPAC name is 2-butyl-5-methylcyclopenta-1,3-diene;difluorozirconium.
| Compound Name | 2-butyl-5-methylcyclopenta-1,3-diene;difluorozirconium |
|---|---|
| PubChem CID | 174700660 |
| Molecular Formula | C10H16F2Zr |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-butyl-5-methylcyclopenta-1,3-diene;difluorozirconium |
| SMILES | CCCCC1=CC(C)C=C1.F[Zr]F |
| InChI | InChI=1S/C10H16.2FH.Zr/c1-3-4-5-10-7-6-9(2)8-10;;;/h6-9H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | VNIRHQOTZGFYNW-UHFFFAOYSA-L |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |