C18H30OS — CID 154210233
4-dodecyl-7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol (PubChem CID 154210233) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is 4-dodecyl-7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol.
| Compound Name | 4-dodecyl-7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 154210233 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 4-dodecyl-7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol |
| SMILES | CCCCCCCCCCCCC1=CC2SC2(O)C=C1 |
| InChI | InChI=1S/C18H30OS/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-18(19)17(15-16)20-18/h13-15,17,19H,2-12H2,1H3 |
| InChIKey | VVQXIXQADWIOSH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|