C28H43N3O — CID 175818096
6-(benzotriazol-2-yl)-1,4-dioctylcyclohexa-2,4-dien-1-ol (PubChem CID 175818096) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is 6-(benzotriazol-2-yl)-1,4-dioctylcyclohexa-2,4-dien-1-ol.
| Compound Name | 6-(benzotriazol-2-yl)-1,4-dioctylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 175818096 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | 6-(benzotriazol-2-yl)-1,4-dioctylcyclohexa-2,4-dien-1-ol |
| SMILES | CCCCCCCCC1=CC(n2nc3ccccc3n2)C(O)(CCCCCCCC)C=C1 |
| InChI | InChI=1S/C28H43N3O/c1-3-5-7-9-11-13-17-24-20-22-28(32,21-16-12-10-8-6-4-2)27(23-24)31-29-25-18-14-15-19-26(25)30-31/h14-15,18-20,22-23,27,32H,3-13,16-17,21H2,1-2H3 |
| InChIKey | BHNJNTIQNMPAFB-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|