C16H27NO3 — CID 152758756
6-(hydroxyiminomethyl)-3-nonylcyclohexa-2,4-diene-1,1-diol (PubChem CID 152758756) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 6-(hydroxyiminomethyl)-3-nonylcyclohexa-2,4-diene-1,1-diol.
| Compound Name | 6-(hydroxyiminomethyl)-3-nonylcyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 152758756 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 6-(hydroxyiminomethyl)-3-nonylcyclohexa-2,4-diene-1,1-diol |
| SMILES | CCCCCCCCCC1=CC(O)(O)C(C=NO)C=C1 |
| InChI | InChI=1S/C16H27NO3/c1-2-3-4-5-6-7-8-9-14-10-11-15(13-17-20)16(18,19)12-14/h10-13,15,18-20H,2-9H2,1H3 |
| InChIKey | VYOYXVDRFRBWPO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|