C17H27NO3 — CID 156636443
2-hydroxy-1-(6-hydroxyimino-4-nonylcyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 156636443) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-hydroxy-1-(6-hydroxyimino-4-nonylcyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 2-hydroxy-1-(6-hydroxyimino-4-nonylcyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 156636443 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-hydroxy-1-(6-hydroxyimino-4-nonylcyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CCCCCCCCCC1=CC(=NO)C(C(=O)CO)C=C1 |
| InChI | InChI=1S/C17H27NO3/c1-2-3-4-5-6-7-8-9-14-10-11-15(17(20)13-19)16(12-14)18-21/h10-12,15,19,21H,2-9,13H2,1H3 |
| InChIKey | HUBKBYUPTMOWSU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|