C19H23N — CID 154684542
6-methyl-14-propan-2-yl-2-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11-hexaene (PubChem CID 154684542) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 6-methyl-14-propan-2-yl-2-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11-hexaene.
| Compound Name | 6-methyl-14-propan-2-yl-2-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11-hexaene |
|---|---|
| PubChem CID | 154684542 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6-methyl-14-propan-2-yl-2-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11-hexaene |
| SMILES | CC1C=Cc2cc3c(nc2C=C1)=CCC(C(C)C)CC=3 |
| InChI | InChI=1S/C19H23N/c1-13(2)15-7-8-17-12-16-6-4-14(3)5-10-18(16)20-19(17)11-9-15/h4-6,8,10-15H,7,9H2,1-3H3 |
| InChIKey | PXIFATLWKAVAGU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |